2-(3,3,3-trifluoropropylsulfonyl)acetic acid

C5H7F3O4S — CID 57425798

IUPAC2-(3,3,3-trifluoropropylsulfonyl)acetic acid
SMILESO=C(O)CS(=O)(=O)CCC(F)(F)F
InChIInChI=1S/C5H7F3O4S/c6-5(7,8)1-2-13(11,12)3-4(9)10/h1-3H2,(H,9,10)
InChIKeyYCUDMGCIPAJPAG-UHFFFAOYSA-N
MW220.17 g/mol
LogP0.44
Rot. Bonds4

About 2-(3,3,3-trifluoropropylsulfonyl)acetic acid

2-(3,3,3-trifluoropropylsulfonyl)acetic acid (PubChem CID 57425798) has the molecular formula C5H7F3O4S and a molecular weight of 220.17 g/mol. Its IUPAC name is 2-(3,3,3-trifluoropropylsulfonyl)acetic acid.

Molecular Properties

Compound Name2-(3,3,3-trifluoropropylsulfonyl)acetic acid
PubChem CID57425798
Molecular FormulaC5H7F3O4S
Molecular Weight220.17 g/mol
Exact Mass220.00
IUPAC Name2-(3,3,3-trifluoropropylsulfonyl)acetic acid
SMILESO=C(O)CS(=O)(=O)CCC(F)(F)F
InChIInChI=1S/C5H7F3O4S/c6-5(7,8)1-2-13(11,12)3-4(9)10/h1-3H2,(H,9,10)
InChIKeyYCUDMGCIPAJPAG-UHFFFAOYSA-N
XLogP0.44
TPSA71.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500220.17
LogP ≤ 50.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(3,3,3-trifluoropropylsulfonyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,3,3-trifluoropropylsulfonyl)acetic acid?
The IUPAC name of 2-(3,3,3-trifluoropropylsulfonyl)acetic acid (CID 57425798) is 2-(3,3,3-trifluoropropylsulfonyl)acetic acid.
What is the SMILES notation for 2-(3,3,3-trifluoropropylsulfonyl)acetic acid?
The canonical SMILES for 2-(3,3,3-trifluoropropylsulfonyl)acetic acid is O=C(O)CS(=O)(=O)CCC(F)(F)F.
What is the InChIKey of 2-(3,3,3-trifluoropropylsulfonyl)acetic acid?
The InChIKey is YCUDMGCIPAJPAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7F3O4S/c6-5(7,8)1-2-13(11,12)3-4(9)10/h1-3H2,(H,9,10).
What are the key properties of 2-(3,3,3-trifluoropropylsulfonyl)acetic acid?
2-(3,3,3-trifluoropropylsulfonyl)acetic acid has a molecular weight of 220.17 g/mol, XLogP of 0.44, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3,3-trifluoropropylsulfonyl)acetic acid is sourced from PubChem (CID 57425798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).