C16H26FN5O4Si — CID 57429326
2-[2-fluoro-6-(3-trimethylsilylpropylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 57429326) has the molecular formula C16H26FN5O4Si and a molecular weight of 399.50 g/mol. Its IUPAC name is 2-[2-fluoro-6-(3-trimethylsilylpropylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | 2-[2-fluoro-6-(3-trimethylsilylpropylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 57429326 |
| Molecular Formula | C16H26FN5O4Si |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 2-[2-fluoro-6-(3-trimethylsilylpropylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | C[Si](C)(C)CCCNc1nc(F)nc2c1ncn2C1OC(CO)C(O)C1O |
| InChI | InChI=1S/C16H26FN5O4Si/c1-27(2,3)6-4-5-18-13-10-14(21-16(17)20-13)22(8-19-10)15-12(25)11(24)9(7-23)26-15/h8-9,11-12,15,23-25H,4-7H2,1-3H3,(H,18,20,21) |
| InChIKey | HHOLLNTYMXHGFN-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|