C28H20F6N4O — CID 57434821
N-cyclopropyl-N-[[5-[4-(cyclopropylamino)quinazolin-6-yl]-2-fluorophenyl]methyl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 57434821) has the molecular formula C28H20F6N4O and a molecular weight of 542.48 g/mol. Its IUPAC name is N-cyclopropyl-N-[[5-[4-(cyclopropylamino)quinazolin-6-yl]-2-fluorophenyl]methyl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-cyclopropyl-N-[[5-[4-(cyclopropylamino)quinazolin-6-yl]-2-fluorophenyl]methyl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 57434821 |
| Molecular Formula | C28H20F6N4O |
| Molecular Weight | 542.48 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | N-cyclopropyl-N-[[5-[4-(cyclopropylamino)quinazolin-6-yl]-2-fluorophenyl]methyl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | O=C(c1c(F)c(F)c(F)c(F)c1F)N(Cc1cc(-c2ccc3ncnc(NC4CC4)c3c2)ccc1F)C1CC1 |
| InChI | InChI=1S/C28H20F6N4O/c29-19-7-1-13(14-2-8-20-18(10-14)27(36-12-35-20)37-16-3-4-16)9-15(19)11-38(17-5-6-17)28(39)21-22(30)24(32)26(34)25(33)23(21)31/h1-2,7-10,12,16-17H,3-6,11H2,(H,35,36,37) |
| InChIKey | UNHQHVZNOBZOAQ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.48 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|