C33H36N4O4S — CID 57440347
1-[3-[4-(aminomethyl)phenyl]-2-[[3-[naphthalen-2-yl(sulfino)amino]-3-phenylpropanoyl]amino]propanoyl]pyrrolidine (PubChem CID 57440347) has the molecular formula C33H36N4O4S and a molecular weight of 584.74 g/mol. Its IUPAC name is 1-[3-[4-(aminomethyl)phenyl]-2-[[3-[naphthalen-2-yl(sulfino)amino]-3-phenylpropanoyl]amino]propanoyl]pyrrolidine.
| Compound Name | 1-[3-[4-(aminomethyl)phenyl]-2-[[3-[naphthalen-2-yl(sulfino)amino]-3-phenylpropanoyl]amino]propanoyl]pyrrolidine |
|---|---|
| PubChem CID | 57440347 |
| Molecular Formula | C33H36N4O4S |
| Molecular Weight | 584.74 g/mol |
| Exact Mass | 584.25 |
| IUPAC Name | 1-[3-[4-(aminomethyl)phenyl]-2-[[3-[naphthalen-2-yl(sulfino)amino]-3-phenylpropanoyl]amino]propanoyl]pyrrolidine |
| SMILES | NCc1ccc(CC(NC(=O)CC(c2ccccc2)N(c2ccc3ccccc3c2)S(=O)O)C(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C33H36N4O4S/c34-23-25-14-12-24(13-15-25)20-30(33(39)36-18-6-7-19-36)35-32(38)22-31(27-9-2-1-3-10-27)37(42(40)41)29-17-16-26-8-4-5-11-28(26)21-29/h1-5,8-17,21,30-31H,6-7,18-20,22-23,34H2,(H,35,38)(H,40,41) |
| InChIKey | IXCFBJWLFPFYIG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.74 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|