C36H40N4O4S — CID 69332824
1-[3-[4-(azetidin-1-ylmethyl)phenyl]-2-[[3-[naphthalen-2-yl(sulfino)amino]-3-phenylpropanoyl]amino]propanoyl]pyrrolidine (PubChem CID 69332824) has the molecular formula C36H40N4O4S and a molecular weight of 624.81 g/mol. Its IUPAC name is 1-[3-[4-(azetidin-1-ylmethyl)phenyl]-2-[[3-[naphthalen-2-yl(sulfino)amino]-3-phenylpropanoyl]amino]propanoyl]pyrrolidine.
| Compound Name | 1-[3-[4-(azetidin-1-ylmethyl)phenyl]-2-[[3-[naphthalen-2-yl(sulfino)amino]-3-phenylpropanoyl]amino]propanoyl]pyrrolidine |
|---|---|
| PubChem CID | 69332824 |
| Molecular Formula | C36H40N4O4S |
| Molecular Weight | 624.81 g/mol |
| Exact Mass | 624.28 |
| IUPAC Name | 1-[3-[4-(azetidin-1-ylmethyl)phenyl]-2-[[3-[naphthalen-2-yl(sulfino)amino]-3-phenylpropanoyl]amino]propanoyl]pyrrolidine |
| SMILES | O=C(CC(c1ccccc1)N(c1ccc2ccccc2c1)S(=O)O)NC(Cc1ccc(CN2CCC2)cc1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C36H40N4O4S/c41-35(37-33(36(42)39-21-6-7-22-39)23-27-13-15-28(16-14-27)26-38-19-8-20-38)25-34(30-10-2-1-3-11-30)40(45(43)44)32-18-17-29-9-4-5-12-31(29)24-32/h1-5,9-18,24,33-34H,6-8,19-23,25-26H2,(H,37,41)(H,43,44) |
| InChIKey | SRRWQTONYMRRET-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.81 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|