C34H37N3O7S2 — CID 91423956
1-[3-[4-(methylsulfonyloxymethyl)phenyl]-2-[[3-[naphthalen-2-yl(sulfino)amino]-3-phenylpropanoyl]amino]propanoyl]pyrrolidine (PubChem CID 91423956) has the molecular formula C34H37N3O7S2 and a molecular weight of 663.82 g/mol. Its IUPAC name is 1-[3-[4-(methylsulfonyloxymethyl)phenyl]-2-[[3-[naphthalen-2-yl(sulfino)amino]-3-phenylpropanoyl]amino]propanoyl]pyrrolidine.
| Compound Name | 1-[3-[4-(methylsulfonyloxymethyl)phenyl]-2-[[3-[naphthalen-2-yl(sulfino)amino]-3-phenylpropanoyl]amino]propanoyl]pyrrolidine |
|---|---|
| PubChem CID | 91423956 |
| Molecular Formula | C34H37N3O7S2 |
| Molecular Weight | 663.82 g/mol |
| Exact Mass | 663.21 |
| IUPAC Name | 1-[3-[4-(methylsulfonyloxymethyl)phenyl]-2-[[3-[naphthalen-2-yl(sulfino)amino]-3-phenylpropanoyl]amino]propanoyl]pyrrolidine |
| SMILES | CS(=O)(=O)OCc1ccc(CC(NC(=O)CC(c2ccccc2)N(c2ccc3ccccc3c2)S(=O)O)C(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C34H37N3O7S2/c1-46(42,43)44-24-26-15-13-25(14-16-26)21-31(34(39)36-19-7-8-20-36)35-33(38)23-32(28-10-3-2-4-11-28)37(45(40)41)30-18-17-27-9-5-6-12-29(27)22-30/h2-6,9-18,22,31-32H,7-8,19-21,23-24H2,1H3,(H,35,38)(H,40,41) |
| InChIKey | FQKVQMSFZMWJCM-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.82 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|