C37H44N4O4S — CID 69332650
1-[3-[4-(butylaminomethyl)phenyl]-2-[[3-[naphthalen-2-yl(sulfino)amino]-3-phenylpropanoyl]amino]propanoyl]pyrrolidine (PubChem CID 69332650) has the molecular formula C37H44N4O4S and a molecular weight of 640.85 g/mol. Its IUPAC name is 1-[3-[4-(butylaminomethyl)phenyl]-2-[[3-[naphthalen-2-yl(sulfino)amino]-3-phenylpropanoyl]amino]propanoyl]pyrrolidine.
| Compound Name | 1-[3-[4-(butylaminomethyl)phenyl]-2-[[3-[naphthalen-2-yl(sulfino)amino]-3-phenylpropanoyl]amino]propanoyl]pyrrolidine |
|---|---|
| PubChem CID | 69332650 |
| Molecular Formula | C37H44N4O4S |
| Molecular Weight | 640.85 g/mol |
| Exact Mass | 640.31 |
| IUPAC Name | 1-[3-[4-(butylaminomethyl)phenyl]-2-[[3-[naphthalen-2-yl(sulfino)amino]-3-phenylpropanoyl]amino]propanoyl]pyrrolidine |
| SMILES | CCCCNCc1ccc(CC(NC(=O)CC(c2ccccc2)N(c2ccc3ccccc3c2)S(=O)O)C(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C37H44N4O4S/c1-2-3-21-38-27-29-17-15-28(16-18-29)24-34(37(43)40-22-9-10-23-40)39-36(42)26-35(31-12-5-4-6-13-31)41(46(44)45)33-20-19-30-11-7-8-14-32(30)25-33/h4-8,11-20,25,34-35,38H,2-3,9-10,21-24,26-27H2,1H3,(H,39,42)(H,44,45) |
| InChIKey | HVZJTUVBPXWRAO-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.85 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|