C16H19BrO3 — CID 57444871
ethyl 3-[(3-bromophenyl)methyl]-2-oxocyclohexane-1-carboxylate (PubChem CID 57444871) has the molecular formula C16H19BrO3 and a molecular weight of 339.23 g/mol. Its IUPAC name is ethyl 3-[(3-bromophenyl)methyl]-2-oxocyclohexane-1-carboxylate.
| Compound Name | ethyl 3-[(3-bromophenyl)methyl]-2-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 57444871 |
| Molecular Formula | C16H19BrO3 |
| Molecular Weight | 339.23 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | ethyl 3-[(3-bromophenyl)methyl]-2-oxocyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCCC(Cc2cccc(Br)c2)C1=O |
| InChI | InChI=1S/C16H19BrO3/c1-2-20-16(19)14-8-4-6-12(15(14)18)9-11-5-3-7-13(17)10-11/h3,5,7,10,12,14H,2,4,6,8-9H2,1H3 |
| InChIKey | BGNWCLNNSRMJSC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.23 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|