C19H24N4O2 — CID 57445769
(4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl)-(5-methyl-1H-1,2,4-triazol-3-yl)methanone (PubChem CID 57445769) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is (4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl)-(5-methyl-1H-1,2,4-triazol-3-yl)methanone.
| Compound Name | (4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl)-(5-methyl-1H-1,2,4-triazol-3-yl)methanone |
|---|---|
| PubChem CID | 57445769 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | (4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl)-(5-methyl-1H-1,2,4-triazol-3-yl)methanone |
| SMILES | Cc1nc(C(=O)N2CCC(O)(c3ccccc3)C3CCCCC32)n[nH]1 |
| InChI | InChI=1S/C19H24N4O2/c1-13-20-17(22-21-13)18(24)23-12-11-19(25,14-7-3-2-4-8-14)15-9-5-6-10-16(15)23/h2-4,7-8,15-16,25H,5-6,9-12H2,1H3,(H,20,21,22) |
| InChIKey | SSOFWKNUJDOFDQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |