C5H8N6O — CID 57450610
2-(4-amino-2-oxopyrimidin-1-yl)guanidine (PubChem CID 57450610) has the molecular formula C5H8N6O and a molecular weight of 168.16 g/mol. Its IUPAC name is 2-(4-amino-2-oxopyrimidin-1-yl)guanidine.
| Compound Name | 2-(4-amino-2-oxopyrimidin-1-yl)guanidine |
|---|---|
| PubChem CID | 57450610 |
| Molecular Formula | C5H8N6O |
| Molecular Weight | 168.16 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 2-(4-amino-2-oxopyrimidin-1-yl)guanidine |
| SMILES | NC(N)=Nn1ccc(N)nc1=O |
| InChI | InChI=1S/C5H8N6O/c6-3-1-2-11(5(12)9-3)10-4(7)8/h1-2H,(H2,6,9,12)(H4,7,8,10) |
| InChIKey | LMTHXWRVAKSVEO-UHFFFAOYSA-N |
| XLogP | -2.14 |
| TPSA | 125.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.16 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|