C6H11N9O — CID 70438896
1-(4-amino-2-oxopyrimidin-1-yl)-2-(diaminomethylideneamino)guanidine (PubChem CID 70438896) has the molecular formula C6H11N9O and a molecular weight of 225.22 g/mol. Its IUPAC name is 1-(4-amino-2-oxopyrimidin-1-yl)-2-(diaminomethylideneamino)guanidine.
| Compound Name | 1-(4-amino-2-oxopyrimidin-1-yl)-2-(diaminomethylideneamino)guanidine |
|---|---|
| PubChem CID | 70438896 |
| Molecular Formula | C6H11N9O |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 1-(4-amino-2-oxopyrimidin-1-yl)-2-(diaminomethylideneamino)guanidine |
| SMILES | NC(N)=NN=C(N)Nn1ccc(N)nc1=O |
| InChI | InChI=1S/C6H11N9O/c7-3-1-2-15(6(16)11-3)14-5(10)13-12-4(8)9/h1-2H,(H2,7,11,16)(H4,8,9,12)(H3,10,13,14) |
| InChIKey | IQJBGGPKGAVHFI-UHFFFAOYSA-N |
| XLogP | -3.13 |
| TPSA | 175.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|