C12H31O3Si4 — CID 57455665
CID 57455665 (PubChem CID 57455665) has the molecular formula C12H31O3Si4 and a molecular weight of 335.72 g/mol.
| Compound Name | CID 57455665 |
|---|---|
| PubChem CID | 57455665 |
| Molecular Formula | C12H31O3Si4 |
| Molecular Weight | 335.72 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)OC(CC[Si])(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C12H31O3Si4/c1-17(2,3)13-12(10-11-16,14-18(4,5)6)15-19(7,8)9/h10-11H2,1-9H3 |
| InChIKey | BQHOVSKSIRATPZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.72 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|