C25H19F3N2O2S — CID 57469004
3-[3-[6-methyl-4-[4-(trifluoromethyl)phenyl]-2-pyridinyl]phenyl]benzenesulfonamide (PubChem CID 57469004) has the molecular formula C25H19F3N2O2S and a molecular weight of 468.50 g/mol. Its IUPAC name is 3-[3-[6-methyl-4-[4-(trifluoromethyl)phenyl]-2-pyridinyl]phenyl]benzenesulfonamide.
| Compound Name | 3-[3-[6-methyl-4-[4-(trifluoromethyl)phenyl]-2-pyridinyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 57469004 |
| Molecular Formula | C25H19F3N2O2S |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 3-[3-[6-methyl-4-[4-(trifluoromethyl)phenyl]-2-pyridinyl]phenyl]benzenesulfonamide |
| SMILES | Cc1cc(-c2ccc(C(F)(F)F)cc2)cc(-c2cccc(-c3cccc(S(N)(=O)=O)c3)c2)n1 |
| InChI | InChI=1S/C25H19F3N2O2S/c1-16-12-21(17-8-10-22(11-9-17)25(26,27)28)15-24(30-16)20-6-2-4-18(13-20)19-5-3-7-23(14-19)33(29,31)32/h2-15H,1H3,(H2,29,31,32) |
| InChIKey | CCVBWYAEPIXTOQ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |