C13H14F2O2 — CID 57470571
ethyl 3-(3-ethenyl-4,5-difluorophenyl)propanoate (PubChem CID 57470571) has the molecular formula C13H14F2O2 and a molecular weight of 240.25 g/mol. Its IUPAC name is ethyl 3-(3-ethenyl-4,5-difluorophenyl)propanoate.
| Compound Name | ethyl 3-(3-ethenyl-4,5-difluorophenyl)propanoate |
|---|---|
| PubChem CID | 57470571 |
| Molecular Formula | C13H14F2O2 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | ethyl 3-(3-ethenyl-4,5-difluorophenyl)propanoate |
| SMILES | C=Cc1cc(CCC(=O)OCC)cc(F)c1F |
| InChI | InChI=1S/C13H14F2O2/c1-3-10-7-9(8-11(14)13(10)15)5-6-12(16)17-4-2/h3,7-8H,1,4-6H2,2H3 |
| InChIKey | OCRHLJBAACFUPQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |