C13H15F2IO3 — CID 68794275
ethyl 3-[3,4-difluoro-5-[(1S)-1-hydroxy-2-iodoethyl]phenyl]propanoate (PubChem CID 68794275) has the molecular formula C13H15F2IO3 and a molecular weight of 384.16 g/mol. Its IUPAC name is ethyl 3-[3,4-difluoro-5-[(1S)-1-hydroxy-2-iodoethyl]phenyl]propanoate.
| Compound Name | ethyl 3-[3,4-difluoro-5-[(1S)-1-hydroxy-2-iodoethyl]phenyl]propanoate |
|---|---|
| PubChem CID | 68794275 |
| Molecular Formula | C13H15F2IO3 |
| Molecular Weight | 384.16 g/mol |
| Exact Mass | 384.00 |
| IUPAC Name | ethyl 3-[3,4-difluoro-5-[(1S)-1-hydroxy-2-iodoethyl]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1cc(F)c(F)c([C@H](O)CI)c1 |
| InChI | InChI=1S/C13H15F2IO3/c1-2-19-12(18)4-3-8-5-9(11(17)7-16)13(15)10(14)6-8/h5-6,11,17H,2-4,7H2,1H3/t11-/m1/s1 |
| InChIKey | NXAYRAFJQJRYKR-LLVKDONJSA-N |
| XLogP | 2.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.16 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|