C16H28N2O8 — CID 575682
10,19-dimethyl-1,4,7,13,16-pentaoxa-10,19-diazacyclohenicosane-11,14,18-trione (PubChem CID 575682) has the molecular formula C16H28N2O8 and a molecular weight of 376.41 g/mol. Its IUPAC name is 10,19-dimethyl-1,4,7,13,16-pentaoxa-10,19-diazacyclohenicosane-11,14,18-trione.
| Compound Name | 10,19-dimethyl-1,4,7,13,16-pentaoxa-10,19-diazacyclohenicosane-11,14,18-trione |
|---|---|
| PubChem CID | 575682 |
| Molecular Formula | C16H28N2O8 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 10,19-dimethyl-1,4,7,13,16-pentaoxa-10,19-diazacyclohenicosane-11,14,18-trione |
| SMILES | CN1CCOCCOCCOCCN(C)C(=O)COC(=O)COCC1=O |
| InChI | InChI=1S/C16H28N2O8/c1-17-3-5-22-7-9-24-10-8-23-6-4-18(2)15(20)12-26-16(21)13-25-11-14(17)19/h3-13H2,1-2H3 |
| InChIKey | XETOLSGRYRUVIN-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 103.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |