C18H22N4O2 — CID 58006648
2-(1,3-benzodioxol-5-yl)-5-(4-propan-2-ylpiperazin-1-yl)pyrazine (PubChem CID 58006648) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-5-(4-propan-2-ylpiperazin-1-yl)pyrazine.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-5-(4-propan-2-ylpiperazin-1-yl)pyrazine |
|---|---|
| PubChem CID | 58006648 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-5-(4-propan-2-ylpiperazin-1-yl)pyrazine |
| SMILES | CC(C)N1CCN(c2cnc(-c3ccc4c(c3)OCO4)cn2)CC1 |
| InChI | InChI=1S/C18H22N4O2/c1-13(2)21-5-7-22(8-6-21)18-11-19-15(10-20-18)14-3-4-16-17(9-14)24-12-23-16/h3-4,9-11,13H,5-8,12H2,1-2H3 |
| InChIKey | VHAPMCMETOZZQS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |