C32H34N4O4 — CID 161259868
1,4-bis[5-(7-methyl-1,3-benzodioxol-5-yl)-2-pyridinyl]-1,4-diazepane;methane (PubChem CID 161259868) has the molecular formula C32H34N4O4 and a molecular weight of 538.65 g/mol. Its IUPAC name is 1,4-bis[5-(7-methyl-1,3-benzodioxol-5-yl)-2-pyridinyl]-1,4-diazepane;methane.
| Compound Name | 1,4-bis[5-(7-methyl-1,3-benzodioxol-5-yl)-2-pyridinyl]-1,4-diazepane;methane |
|---|---|
| PubChem CID | 161259868 |
| Molecular Formula | C32H34N4O4 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | 1,4-bis[5-(7-methyl-1,3-benzodioxol-5-yl)-2-pyridinyl]-1,4-diazepane;methane |
| SMILES | C.Cc1cc(-c2ccc(N3CCCN(c4ccc(-c5cc(C)c6c(c5)OCO6)cn4)CC3)nc2)cc2c1OCO2 |
| InChI | InChI=1S/C31H30N4O4.CH4/c1-20-12-24(14-26-30(20)38-18-36-26)22-4-6-28(32-16-22)34-8-3-9-35(11-10-34)29-7-5-23(17-33-29)25-13-21(2)31-27(15-25)37-19-39-31;/h4-7,12-17H,3,8-11,18-19H2,1-2H3;1H4 |
| InChIKey | VCKJGQRGJCKUEW-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |