C26H23N3O3 — CID 58012902
2-[3-[4-[bis(1H-pyrrol-2-yl)methyl]phenoxy]propyl]isoindole-1,3-dione (PubChem CID 58012902) has the molecular formula C26H23N3O3 and a molecular weight of 425.49 g/mol. Its IUPAC name is 2-[3-[4-[bis(1H-pyrrol-2-yl)methyl]phenoxy]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[4-[bis(1H-pyrrol-2-yl)methyl]phenoxy]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58012902 |
| Molecular Formula | C26H23N3O3 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 2-[3-[4-[bis(1H-pyrrol-2-yl)methyl]phenoxy]propyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCOc1ccc(C(c2ccc[nH]2)c2ccc[nH]2)cc1 |
| InChI | InChI=1S/C26H23N3O3/c30-25-20-6-1-2-7-21(20)26(31)29(25)16-5-17-32-19-12-10-18(11-13-19)24(22-8-3-14-27-22)23-9-4-15-28-23/h1-4,6-15,24,27-28H,5,16-17H2 |
| InChIKey | YBRYBOCZKAZWSW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 78.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|