C54H46N4O11Zn — CID 58019362
zinc 4-[10,15,20-tris(3,4,5-trimethoxyphenyl)porphyrin-22,24-diid-5-yl]benzoic acid (PubChem CID 58019362) has the molecular formula C54H46N4O11Zn and a molecular weight of 992.37 g/mol. Its IUPAC name is zinc 4-[10,15,20-tris(3,4,5-trimethoxyphenyl)porphyrin-22,24-diid-5-yl]benzoic acid.
| Compound Name | zinc 4-[10,15,20-tris(3,4,5-trimethoxyphenyl)porphyrin-22,24-diid-5-yl]benzoic acid |
|---|---|
| PubChem CID | 58019362 |
| Molecular Formula | C54H46N4O11Zn |
| Molecular Weight | 992.37 g/mol |
| Exact Mass | 990.25 |
| IUPAC Name | zinc 4-[10,15,20-tris(3,4,5-trimethoxyphenyl)porphyrin-22,24-diid-5-yl]benzoic acid |
| SMILES | COc1cc(-c2c3nc(c(-c4cc(OC)c(OC)c(OC)c4)c4ccc([n-]4)c(-c4cc(OC)c(OC)c(OC)c4)c4nc(c(-c5ccc(C(=O)O)cc5)c5ccc2[n-]5)C=C4)C=C3)cc(OC)c1OC.[Zn+2] |
| InChI | InChI=1S/C54H47N4O11.Zn/c1-61-41-22-30(23-42(62-2)51(41)67-7)48-35-16-14-33(55-35)47(28-10-12-29(13-11-28)54(59)60)34-15-17-36(56-34)49(31-24-43(63-3)52(68-8)44(25-31)64-4)38-19-21-40(58-38)50(39-20-18-37(48)57-39)32-26-45(65-5)53(69-9)46(27-32)66-6;/h10-27H,1-9H3,(H2-,55,56,57,58,59,60);/q-1;+2/p-1/b47-33-,47-34-,48-35-,48-37-,49-36-,49-38-,50-39-,50-40-; |
| InChIKey | MYPDJZSTQQHTBR-VXIKXBHVSA-M |
| XLogP | 10.35 |
| TPSA | 174.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 992.37 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|