C56H52N4O13V — CID 6321152
oxovanadium(2+);5,10,15,20-tetrakis(3,4,5-trimethoxyphenyl)porphyrin-22,23-diide (PubChem CID 6321152) has the molecular formula C56H52N4O13V and a molecular weight of 1039.99 g/mol. Its IUPAC name is oxovanadium(2+);5,10,15,20-tetrakis(3,4,5-trimethoxyphenyl)porphyrin-22,23-diide.
| Compound Name | oxovanadium(2+);5,10,15,20-tetrakis(3,4,5-trimethoxyphenyl)porphyrin-22,23-diide |
|---|---|
| PubChem CID | 6321152 |
| Molecular Formula | C56H52N4O13V |
| Molecular Weight | 1039.99 g/mol |
| Exact Mass | 1039.30 |
| IUPAC Name | oxovanadium(2+);5,10,15,20-tetrakis(3,4,5-trimethoxyphenyl)porphyrin-22,23-diide |
| SMILES | COc1cc(-c2c3nc(c(-c4cc(OC)c(OC)c(OC)c4)c4ccc([n-]4)c(-c4cc(OC)c(OC)c(OC)c4)c4ccc([n-]4)c(-c4cc(OC)c(OC)c(OC)c4)c4nc2C=C4)C=C3)cc(OC)c1OC.O=[V+2] |
| InChI | InChI=1S/C56H52N4O12.O.V/c1-61-41-21-29(22-42(62-2)53(41)69-9)49-33-13-15-35(57-33)50(30-23-43(63-3)54(70-10)44(24-30)64-4)37-17-19-39(59-37)52(32-27-47(67-7)56(72-12)48(28-32)68-8)40-20-18-38(60-40)51(36-16-14-34(49)58-36)31-25-45(65-5)55(71-11)46(26-31)66-6;;/h13-28H,1-12H3;;/q-2;;+2/b49-33-,49-34-,50-35-,50-37-,51-36-,51-38-,52-39-,52-40-;; |
| InChIKey | KYCGPAWSJWUADC-FROCSNILSA-N |
| XLogP | 10.56 |
| TPSA | 181.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 74 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1039.99 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |