C54H47CoN4O4 — CID 11125783
cobalt(3+);cyclohexane;5,10,15,20-tetrakis(4-methoxyphenyl)porphyrin-22,24-diide (PubChem CID 11125783) has the molecular formula C54H47CoN4O4 and a molecular weight of 874.93 g/mol. Its IUPAC name is cobalt(3+);cyclohexane;5,10,15,20-tetrakis(4-methoxyphenyl)porphyrin-22,24-diide.
| Compound Name | cobalt(3+);cyclohexane;5,10,15,20-tetrakis(4-methoxyphenyl)porphyrin-22,24-diide |
|---|---|
| PubChem CID | 11125783 |
| Molecular Formula | C54H47CoN4O4 |
| Molecular Weight | 874.93 g/mol |
| Exact Mass | 874.29 |
| IUPAC Name | cobalt(3+);cyclohexane;5,10,15,20-tetrakis(4-methoxyphenyl)porphyrin-22,24-diide |
| SMILES | COc1ccc(-c2c3nc(c(-c4ccc(OC)cc4)c4ccc([n-]4)c(-c4ccc(OC)cc4)c4nc(c(-c5ccc(OC)cc5)c5ccc2[n-]5)C=C4)C=C3)cc1.[CH-]1CCCCC1.[Co+3] |
| InChI | InChI=1S/C48H36N4O4.C6H11.Co/c1-53-33-13-5-29(6-14-33)45-37-21-23-39(49-37)46(30-7-15-34(54-2)16-8-30)41-25-27-43(51-41)48(32-11-19-36(56-4)20-12-32)44-28-26-42(52-44)47(40-24-22-38(45)50-40)31-9-17-35(55-3)18-10-31;1-2-4-6-5-3-1;/h5-28H,1-4H3;1H,2-6H2;/q-2;-1;+3/b45-37-,45-38-,46-39-,46-41-,47-40-,47-42-,48-43-,48-44-;; |
| InChIKey | BWRRJRIILKDSCQ-HTMHXADGSA-N |
| XLogP | 12.77 |
| TPSA | 90.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.93 |
| LogP ≤ 5 | 12.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|