C54H50N6O3Zn — CID 50902973
zinc N'-[4-[10,15,20-tris(4-methoxyphenyl)porphyrin-22,24-diid-5-yl]phenyl]heptane-1,7-diamine (PubChem CID 50902973) has the molecular formula C54H50N6O3Zn and a molecular weight of 896.42 g/mol. Its IUPAC name is zinc N'-[4-[10,15,20-tris(4-methoxyphenyl)porphyrin-22,24-diid-5-yl]phenyl]heptane-1,7-diamine.
| Compound Name | zinc N'-[4-[10,15,20-tris(4-methoxyphenyl)porphyrin-22,24-diid-5-yl]phenyl]heptane-1,7-diamine |
|---|---|
| PubChem CID | 50902973 |
| Molecular Formula | C54H50N6O3Zn |
| Molecular Weight | 896.42 g/mol |
| Exact Mass | 894.32 |
| IUPAC Name | zinc N'-[4-[10,15,20-tris(4-methoxyphenyl)porphyrin-22,24-diid-5-yl]phenyl]heptane-1,7-diamine |
| SMILES | COc1ccc(-c2c3nc(c(-c4ccc(OC)cc4)c4ccc([n-]4)c(-c4ccc(OC)cc4)c4nc(c(-c5ccc(NCCCCCCCN)cc5)c5ccc2[n-]5)C=C4)C=C3)cc1.[Zn+2] |
| InChI | InChI=1S/C54H50N6O3.Zn/c1-61-40-19-11-36(12-20-40)52-45-27-25-43(57-45)51(35-9-17-39(18-10-35)56-34-8-6-4-5-7-33-55)44-26-28-46(58-44)53(37-13-21-41(62-2)22-14-37)48-30-32-50(60-48)54(49-31-29-47(52)59-49)38-15-23-42(63-3)24-16-38;/h9-32,56H,4-8,33-34,55H2,1-3H3;/q-2;+2/b51-43-,51-44-,52-45-,52-47-,53-46-,53-48-,54-49-,54-50-; |
| InChIKey | WFGOYIZKKOVCNC-OVNMMQRWSA-N |
| XLogP | 11.93 |
| TPSA | 119.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 896.42 |
| LogP ≤ 5 | 11.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|