C22H27ClN2O2 — CID 58026249
tert-butyl (3E)-6-chloro-3-(1-cyanoethylidene)-5-methylspiro[2H-indene-1,4'-piperidine]-1'-carboxylate (PubChem CID 58026249) has the molecular formula C22H27ClN2O2 and a molecular weight of 386.92 g/mol. Its IUPAC name is tert-butyl (3E)-6-chloro-3-(1-cyanoethylidene)-5-methylspiro[2H-indene-1,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl (3E)-6-chloro-3-(1-cyanoethylidene)-5-methylspiro[2H-indene-1,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 58026249 |
| Molecular Formula | C22H27ClN2O2 |
| Molecular Weight | 386.92 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | tert-butyl (3E)-6-chloro-3-(1-cyanoethylidene)-5-methylspiro[2H-indene-1,4'-piperidine]-1'-carboxylate |
| SMILES | C/C(C#N)=C1/CC2(CCN(C(=O)OC(C)(C)C)CC2)c2cc(Cl)c(C)cc21 |
| InChI | InChI=1S/C22H27ClN2O2/c1-14-10-16-17(15(2)13-24)12-22(18(16)11-19(14)23)6-8-25(9-7-22)20(26)27-21(3,4)5/h10-11H,6-9,12H2,1-5H3/b17-15+ |
| InChIKey | LIXINBUNWKWUGS-BMRADRMJSA-N |
| XLogP | 5.62 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.92 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|