About trilithium;2-[bis(2-methylazanidylethyl)amino]ethyl-methylazanide
trilithium;2-[bis(2-methylazanidylethyl)amino]ethyl-methylazanide (PubChem CID 58027832) has the molecular formula C9H21Li3N4
and a molecular weight of 206.12 g/mol. Its IUPAC name is trilithium;2-[bis(2-methylazanidylethyl)amino]ethyl-methylazanide.
Molecular Properties
| Compound Name | trilithium;2-[bis(2-methylazanidylethyl)amino]ethyl-methylazanide |
| PubChem CID | 58027832 |
| Molecular Formula | C9H21Li3N4 |
| Molecular Weight | 206.12 g/mol |
| Exact Mass | 206.22 |
| IUPAC Name | trilithium;2-[bis(2-methylazanidylethyl)amino]ethyl-methylazanide |
| SMILES | C[N-]CCN(CC[N-]C)CC[N-]C.[Li+].[Li+].[Li+] |
| InChI | InChI=1S/C9H21N4.3Li/c1-10-4-7-13(8-5-11-2)9-6-12-3;;;/h4-9H2,1-3H3;;;/q-3;3*+1 |
| InChIKey | TYBHZXBFLAJHKZ-UHFFFAOYSA-N |
| XLogP | -7.69 |
| TPSA | 45.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.12 |
| LogP ≤ 5 | -7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze trilithium;2-[bis(2-methylazanidylethyl)amino]ethyl-methylazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trilithium;2-[bis(2-methylazanidylethyl)amino]ethyl-methylazanide?
The IUPAC name of trilithium;2-[bis(2-methylazanidylethyl)amino]ethyl-methylazanide (CID 58027832) is trilithium;2-[bis(2-methylazanidylethyl)amino]ethyl-methylazanide.
What is the SMILES notation for trilithium;2-[bis(2-methylazanidylethyl)amino]ethyl-methylazanide?
The canonical SMILES for trilithium;2-[bis(2-methylazanidylethyl)amino]ethyl-methylazanide is C[N-]CCN(CC[N-]C)CC[N-]C.[Li+].[Li+].[Li+].
What is the InChIKey of trilithium;2-[bis(2-methylazanidylethyl)amino]ethyl-methylazanide?
The InChIKey is TYBHZXBFLAJHKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N4.3Li/c1-10-4-7-13(8-5-11-2)9-6-12-3;;;/h4-9H2,1-3H3;;;/q-3;3*+1.
What are the key properties of trilithium;2-[bis(2-methylazanidylethyl)amino]ethyl-methylazanide?
trilithium;2-[bis(2-methylazanidylethyl)amino]ethyl-methylazanide has a molecular weight of 206.12 g/mol, XLogP of -7.69, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trilithium;2-[bis(2-methylazanidylethyl)amino]ethyl-methylazanide is sourced from PubChem (CID 58027832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).