C36H49NO9 — CID 58030553
1-O-[6-[4-(4-acetyloxy-2-methylphenoxy)carbonylphenoxy]hexyl] 4-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) butanedioate (PubChem CID 58030553) has the molecular formula C36H49NO9 and a molecular weight of 639.79 g/mol. Its IUPAC name is 1-O-[6-[4-(4-acetyloxy-2-methylphenoxy)carbonylphenoxy]hexyl] 4-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) butanedioate.
| Compound Name | 1-O-[6-[4-(4-acetyloxy-2-methylphenoxy)carbonylphenoxy]hexyl] 4-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) butanedioate |
|---|---|
| PubChem CID | 58030553 |
| Molecular Formula | C36H49NO9 |
| Molecular Weight | 639.79 g/mol |
| Exact Mass | 639.34 |
| IUPAC Name | 1-O-[6-[4-(4-acetyloxy-2-methylphenoxy)carbonylphenoxy]hexyl] 4-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) butanedioate |
| SMILES | CC(=O)Oc1ccc(OC(=O)c2ccc(OCCCCCCOC(=O)CCC(=O)OC3CC(C)(C)N(C)C(C)(C)C3)cc2)c(C)c1 |
| InChI | InChI=1S/C36H49NO9/c1-25-22-29(44-26(2)38)16-17-31(25)46-34(41)27-12-14-28(15-13-27)42-20-10-8-9-11-21-43-32(39)18-19-33(40)45-30-23-35(3,4)37(7)36(5,6)24-30/h12-17,22,30H,8-11,18-21,23-24H2,1-7H3 |
| InChIKey | NCZIMXPKSFYIOY-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.79 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|