C19H23N4O2+ — CID 58036069
1-(6-methoxynaphthalen-2-yl)-2-(3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decan-1-yl)ethanone (PubChem CID 58036069) has the molecular formula C19H23N4O2+ and a molecular weight of 339.42 g/mol. Its IUPAC name is 1-(6-methoxynaphthalen-2-yl)-2-(3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decan-1-yl)ethanone.
| Compound Name | 1-(6-methoxynaphthalen-2-yl)-2-(3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decan-1-yl)ethanone |
|---|---|
| PubChem CID | 58036069 |
| Molecular Formula | C19H23N4O2+ |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 1-(6-methoxynaphthalen-2-yl)-2-(3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decan-1-yl)ethanone |
| SMILES | COc1ccc2cc(C(=O)C[N+]34CN5CN(CN(C5)C3)C4)ccc2c1 |
| InChI | InChI=1S/C19H23N4O2/c1-25-18-5-4-15-6-17(3-2-16(15)7-18)19(24)8-23-12-20-9-21(13-23)11-22(10-20)14-23/h2-7H,8-14H2,1H3/q+1 |
| InChIKey | LLNCOSKWKBRJFF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|