C15H21BrN4O2 — CID 10474230
1-(4-methoxyphenyl)-2-(3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decan-1-yl)ethanone bromide (PubChem CID 10474230) has the molecular formula C15H21BrN4O2 and a molecular weight of 369.26 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2-(3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decan-1-yl)ethanone bromide.
| Compound Name | 1-(4-methoxyphenyl)-2-(3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decan-1-yl)ethanone bromide |
|---|---|
| PubChem CID | 10474230 |
| Molecular Formula | C15H21BrN4O2 |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 1-(4-methoxyphenyl)-2-(3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decan-1-yl)ethanone bromide |
| SMILES | COc1ccc(C(=O)C[N+]23CN4CN(CN(C4)C2)C3)cc1.[Br-] |
| InChI | InChI=1S/C15H21N4O2.BrH/c1-21-14-4-2-13(3-5-14)15(20)6-19-10-16-7-17(11-19)9-18(8-16)12-19;/h2-5H,6-12H2,1H3;1H/q+1;/p-1 |
| InChIKey | VTCOQNIGNSOMPG-UHFFFAOYSA-M |
| XLogP | -2.61 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|