C17H19N5O3 — CID 58040323
4-[[4-ethoxy-6-[(5-methylfuran-2-yl)methylamino]-1,3,5-triazin-2-yl]amino]phenol (PubChem CID 58040323) has the molecular formula C17H19N5O3 and a molecular weight of 341.37 g/mol. Its IUPAC name is 4-[[4-ethoxy-6-[(5-methylfuran-2-yl)methylamino]-1,3,5-triazin-2-yl]amino]phenol.
| Compound Name | 4-[[4-ethoxy-6-[(5-methylfuran-2-yl)methylamino]-1,3,5-triazin-2-yl]amino]phenol |
|---|---|
| PubChem CID | 58040323 |
| Molecular Formula | C17H19N5O3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 4-[[4-ethoxy-6-[(5-methylfuran-2-yl)methylamino]-1,3,5-triazin-2-yl]amino]phenol |
| SMILES | CCOc1nc(NCc2ccc(C)o2)nc(Nc2ccc(O)cc2)n1 |
| InChI | InChI=1S/C17H19N5O3/c1-3-24-17-21-15(18-10-14-9-4-11(2)25-14)20-16(22-17)19-12-5-7-13(23)8-6-12/h4-9,23H,3,10H2,1-2H3,(H2,18,19,20,21,22) |
| InChIKey | WSJZMSKGSQQSOQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|