C19H20F3N5O2 — CID 58039352
2-N-(3-ethylphenyl)-4-N-[(5-methylfuran-2-yl)methyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine (PubChem CID 58039352) has the molecular formula C19H20F3N5O2 and a molecular weight of 407.40 g/mol. Its IUPAC name is 2-N-(3-ethylphenyl)-4-N-[(5-methylfuran-2-yl)methyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(3-ethylphenyl)-4-N-[(5-methylfuran-2-yl)methyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 58039352 |
| Molecular Formula | C19H20F3N5O2 |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 2-N-(3-ethylphenyl)-4-N-[(5-methylfuran-2-yl)methyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine |
| SMILES | CCc1cccc(Nc2nc(NCc3ccc(C)o3)nc(OCC(F)(F)F)n2)c1 |
| InChI | InChI=1S/C19H20F3N5O2/c1-3-13-5-4-6-14(9-13)24-17-25-16(23-10-15-8-7-12(2)29-15)26-18(27-17)28-11-19(20,21)22/h4-9H,3,10-11H2,1-2H3,(H2,23,24,25,26,27) |
| InChIKey | FQIYEVBJOVGDAT-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |