C22H25F3N6O3 — CID 58040158
4-N-[(5-methylfuran-2-yl)methyl]-2-N-[3-(morpholin-4-ylmethyl)phenyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine (PubChem CID 58040158) has the molecular formula C22H25F3N6O3 and a molecular weight of 478.48 g/mol. Its IUPAC name is 4-N-[(5-methylfuran-2-yl)methyl]-2-N-[3-(morpholin-4-ylmethyl)phenyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[(5-methylfuran-2-yl)methyl]-2-N-[3-(morpholin-4-ylmethyl)phenyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 58040158 |
| Molecular Formula | C22H25F3N6O3 |
| Molecular Weight | 478.48 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 4-N-[(5-methylfuran-2-yl)methyl]-2-N-[3-(morpholin-4-ylmethyl)phenyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccc(CNc2nc(Nc3cccc(CN4CCOCC4)c3)nc(OCC(F)(F)F)n2)o1 |
| InChI | InChI=1S/C22H25F3N6O3/c1-15-5-6-18(34-15)12-26-19-28-20(30-21(29-19)33-14-22(23,24)25)27-17-4-2-3-16(11-17)13-31-7-9-32-10-8-31/h2-6,11H,7-10,12-14H2,1H3,(H2,26,27,28,29,30) |
| InChIKey | OHMRHSRCJUJCLR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 97.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |