C22H22F3N7O2S — CID 58039983
4-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]-N-[(5-methylfuran-2-yl)methyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine (PubChem CID 58039983) has the molecular formula C22H22F3N7O2S and a molecular weight of 505.53 g/mol. Its IUPAC name is 4-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]-N-[(5-methylfuran-2-yl)methyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine.
| Compound Name | 4-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]-N-[(5-methylfuran-2-yl)methyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 58039983 |
| Molecular Formula | C22H22F3N7O2S |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | 4-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]-N-[(5-methylfuran-2-yl)methyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine |
| SMILES | Cc1ccc(CNc2nc(OCC(F)(F)F)nc(N3CCN(c4nc5ccccc5s4)CC3)n2)o1 |
| InChI | InChI=1S/C22H22F3N7O2S/c1-14-6-7-15(34-14)12-26-18-28-19(30-20(29-18)33-13-22(23,24)25)31-8-10-32(11-9-31)21-27-16-4-2-3-5-17(16)35-21/h2-7H,8-13H2,1H3,(H,26,28,29,30) |
| InChIKey | YDHSWKDPIJIHSF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 92.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |