C48H41F3N2O — CID 58050603
6-N-(4-methylphenyl)-1-N,6-N-diphenyl-3,8-di(propan-2-yl)-1-N-[4-(trifluoromethoxy)phenyl]pyrene-1,6-diamine (PubChem CID 58050603) has the molecular formula C48H41F3N2O and a molecular weight of 718.86 g/mol. Its IUPAC name is 6-N-(4-methylphenyl)-1-N,6-N-diphenyl-3,8-di(propan-2-yl)-1-N-[4-(trifluoromethoxy)phenyl]pyrene-1,6-diamine.
| Compound Name | 6-N-(4-methylphenyl)-1-N,6-N-diphenyl-3,8-di(propan-2-yl)-1-N-[4-(trifluoromethoxy)phenyl]pyrene-1,6-diamine |
|---|---|
| PubChem CID | 58050603 |
| Molecular Formula | C48H41F3N2O |
| Molecular Weight | 718.86 g/mol |
| Exact Mass | 718.32 |
| IUPAC Name | 6-N-(4-methylphenyl)-1-N,6-N-diphenyl-3,8-di(propan-2-yl)-1-N-[4-(trifluoromethoxy)phenyl]pyrene-1,6-diamine |
| SMILES | Cc1ccc(N(c2ccccc2)c2cc(C(C)C)c3ccc4c(N(c5ccccc5)c5ccc(OC(F)(F)F)cc5)cc(C(C)C)c5ccc2c3c54)cc1 |
| InChI | InChI=1S/C48H41F3N2O/c1-30(2)42-28-44(52(33-12-8-6-9-13-33)35-18-16-32(5)17-19-35)40-26-24-39-43(31(3)4)29-45(41-27-25-38(42)46(40)47(39)41)53(34-14-10-7-11-15-34)36-20-22-37(23-21-36)54-48(49,50)51/h6-31H,1-5H3 |
| InChIKey | ZPSXBIFFULVOJW-UHFFFAOYSA-N |
| XLogP | 14.98 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.86 |
| LogP ≤ 5 | 14.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|