C12H20NO+ — CID 58051714
5-[(2S)-3,3-dimethylbutan-2-yl]-1-hydroxy-2-methylpyridin-1-ium (PubChem CID 58051714) has the molecular formula C12H20NO+ and a molecular weight of 194.30 g/mol. Its IUPAC name is 5-[(2S)-3,3-dimethylbutan-2-yl]-1-hydroxy-2-methylpyridin-1-ium.
| Compound Name | 5-[(2S)-3,3-dimethylbutan-2-yl]-1-hydroxy-2-methylpyridin-1-ium |
|---|---|
| PubChem CID | 58051714 |
| Molecular Formula | C12H20NO+ |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 5-[(2S)-3,3-dimethylbutan-2-yl]-1-hydroxy-2-methylpyridin-1-ium |
| SMILES | Cc1ccc([C@@H](C)C(C)(C)C)c[n+]1O |
| InChI | InChI=1S/C12H20NO/c1-9-6-7-11(8-13(9)14)10(2)12(3,4)5/h6-8,10,14H,1-5H3/q+1/t10-/m1/s1 |
| InChIKey | BLENMCHJRLHPCT-SNVBAGLBSA-N |
| XLogP | 2.67 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|