C23H28F2N2O3 — CID 58054141
methyl (2S)-2-[2-[3-(3,4-difluorophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,5-a]azepin-1-yl]-2-oxoethyl]-3,3-dimethylbutanoate (PubChem CID 58054141) has the molecular formula C23H28F2N2O3 and a molecular weight of 418.48 g/mol. Its IUPAC name is methyl (2S)-2-[2-[3-(3,4-difluorophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,5-a]azepin-1-yl]-2-oxoethyl]-3,3-dimethylbutanoate.
| Compound Name | methyl (2S)-2-[2-[3-(3,4-difluorophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,5-a]azepin-1-yl]-2-oxoethyl]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 58054141 |
| Molecular Formula | C23H28F2N2O3 |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | methyl (2S)-2-[2-[3-(3,4-difluorophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,5-a]azepin-1-yl]-2-oxoethyl]-3,3-dimethylbutanoate |
| SMILES | COC(=O)[C@@H](CC(=O)c1nc(-c2ccc(F)c(F)c2)n2c1CCCCC2)C(C)(C)C |
| InChI | InChI=1S/C23H28F2N2O3/c1-23(2,3)15(22(29)30-4)13-19(28)20-18-8-6-5-7-11-27(18)21(26-20)14-9-10-16(24)17(25)12-14/h9-10,12,15H,5-8,11,13H2,1-4H3/t15-/m1/s1 |
| InChIKey | QJERUMDAJTXDQN-OAHLLOKOSA-N |
| XLogP | 4.96 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |