C25H22N4O2 — CID 58054770
(4-methoxyphenyl)-(5-methyl-4-phenyl-3,4,9,11-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),2,5,11,13-pentaen-9-yl)methanone (PubChem CID 58054770) has the molecular formula C25H22N4O2 and a molecular weight of 410.48 g/mol. Its IUPAC name is (4-methoxyphenyl)-(5-methyl-4-phenyl-3,4,9,11-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),2,5,11,13-pentaen-9-yl)methanone.
| Compound Name | (4-methoxyphenyl)-(5-methyl-4-phenyl-3,4,9,11-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),2,5,11,13-pentaen-9-yl)methanone |
|---|---|
| PubChem CID | 58054770 |
| Molecular Formula | C25H22N4O2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | (4-methoxyphenyl)-(5-methyl-4-phenyl-3,4,9,11-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),2,5,11,13-pentaen-9-yl)methanone |
| SMILES | COc1ccc(C(=O)N2CCc3c(nn(-c4ccccc4)c3C)-c3cccnc32)cc1 |
| InChI | InChI=1S/C25H22N4O2/c1-17-21-14-16-28(25(30)18-10-12-20(31-2)13-11-18)24-22(9-6-15-26-24)23(21)27-29(17)19-7-4-3-5-8-19/h3-13,15H,14,16H2,1-2H3 |
| InChIKey | VGBOBNGWRUWEEK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |