C18H25N3O4S — CID 58055883
tert-butyl N-[C-methylsulfanyl-N-[1-(3-nitrophenyl)cyclopentyl]carbonimidoyl]carbamate (PubChem CID 58055883) has the molecular formula C18H25N3O4S and a molecular weight of 379.48 g/mol. Its IUPAC name is tert-butyl N-[C-methylsulfanyl-N-[1-(3-nitrophenyl)cyclopentyl]carbonimidoyl]carbamate.
| Compound Name | tert-butyl N-[C-methylsulfanyl-N-[1-(3-nitrophenyl)cyclopentyl]carbonimidoyl]carbamate |
|---|---|
| PubChem CID | 58055883 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | tert-butyl N-[C-methylsulfanyl-N-[1-(3-nitrophenyl)cyclopentyl]carbonimidoyl]carbamate |
| SMILES | CS/C(=N\C1(c2cccc([N+](=O)[O-])c2)CCCC1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H25N3O4S/c1-17(2,3)25-16(22)19-15(26-4)20-18(10-5-6-11-18)13-8-7-9-14(12-13)21(23)24/h7-9,12H,5-6,10-11H2,1-4H3,(H,19,20,22) |
| InChIKey | YSFZNNUMDBFBRJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|