C19H18BrN3O2 — CID 58056713
benzyl (2S)-2-(5-bromoimidazo[1,2-a]pyridin-2-yl)pyrrolidine-1-carboxylate (PubChem CID 58056713) has the molecular formula C19H18BrN3O2 and a molecular weight of 400.28 g/mol. Its IUPAC name is benzyl (2S)-2-(5-bromoimidazo[1,2-a]pyridin-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-(5-bromoimidazo[1,2-a]pyridin-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58056713 |
| Molecular Formula | C19H18BrN3O2 |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | benzyl (2S)-2-(5-bromoimidazo[1,2-a]pyridin-2-yl)pyrrolidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC[C@H]1c1cn2c(Br)cccc2n1 |
| InChI | InChI=1S/C19H18BrN3O2/c20-17-9-4-10-18-21-15(12-23(17)18)16-8-5-11-22(16)19(24)25-13-14-6-2-1-3-7-14/h1-4,6-7,9-10,12,16H,5,8,11,13H2/t16-/m0/s1 |
| InChIKey | HWIPVLPDLDQSDF-INIZCTEOSA-N |
| XLogP | 4.57 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|