C23H31N2S+ — CID 58058208
2-[(E)-[1-(2-cyclopentylethyl)-3-ethenyl-3-methylindol-2-ylidene]methyl]-3-methyl-4,5-dihydro-1,3-thiazol-3-ium (PubChem CID 58058208) has the molecular formula C23H31N2S+ and a molecular weight of 367.58 g/mol. Its IUPAC name is 2-[(E)-[1-(2-cyclopentylethyl)-3-ethenyl-3-methylindol-2-ylidene]methyl]-3-methyl-4,5-dihydro-1,3-thiazol-3-ium.
| Compound Name | 2-[(E)-[1-(2-cyclopentylethyl)-3-ethenyl-3-methylindol-2-ylidene]methyl]-3-methyl-4,5-dihydro-1,3-thiazol-3-ium |
|---|---|
| PubChem CID | 58058208 |
| Molecular Formula | C23H31N2S+ |
| Molecular Weight | 367.58 g/mol |
| Exact Mass | 367.22 |
| IUPAC Name | 2-[(E)-[1-(2-cyclopentylethyl)-3-ethenyl-3-methylindol-2-ylidene]methyl]-3-methyl-4,5-dihydro-1,3-thiazol-3-ium |
| SMILES | C=CC1(C)/C(=C\C2=[N+](C)CCS2)N(CCC2CCCC2)c2ccccc21 |
| InChI | InChI=1S/C23H31N2S/c1-4-23(2)19-11-7-8-12-20(19)25(14-13-18-9-5-6-10-18)21(23)17-22-24(3)15-16-26-22/h4,7-8,11-12,17-18H,1,5-6,9-10,13-16H2,2-3H3/q+1 |
| InChIKey | KDBUYJQMGNYTGU-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.58 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|