C18H17F3O3 — CID 58060982
3-[[2,3-dimethyl-4-(trifluoromethyl)phenyl]-hydroxymethylidene]bicyclo[3.2.1]octane-2,4-dione (PubChem CID 58060982) has the molecular formula C18H17F3O3 and a molecular weight of 338.33 g/mol. Its IUPAC name is 3-[[2,3-dimethyl-4-(trifluoromethyl)phenyl]-hydroxymethylidene]bicyclo[3.2.1]octane-2,4-dione.
| Compound Name | 3-[[2,3-dimethyl-4-(trifluoromethyl)phenyl]-hydroxymethylidene]bicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 58060982 |
| Molecular Formula | C18H17F3O3 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 3-[[2,3-dimethyl-4-(trifluoromethyl)phenyl]-hydroxymethylidene]bicyclo[3.2.1]octane-2,4-dione |
| SMILES | Cc1c(C(O)=C2C(=O)C3CCC(C3)C2=O)ccc(C(F)(F)F)c1C |
| InChI | InChI=1S/C18H17F3O3/c1-8-9(2)13(18(19,20)21)6-5-12(8)17(24)14-15(22)10-3-4-11(7-10)16(14)23/h5-6,10-11,24H,3-4,7H2,1-2H3 |
| InChIKey | MGWBREKXNLJJAQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|