C34H40N2O4 — CID 58064463
methyl 2-[4-[4-[2-methyl-4-(3-phenylpropylcarbamoyl)-2,3-dihydro-1,4-benzoxazin-7-yl]phenyl]cyclohexyl]acetate (PubChem CID 58064463) has the molecular formula C34H40N2O4 and a molecular weight of 540.70 g/mol. Its IUPAC name is methyl 2-[4-[4-[2-methyl-4-(3-phenylpropylcarbamoyl)-2,3-dihydro-1,4-benzoxazin-7-yl]phenyl]cyclohexyl]acetate.
| Compound Name | methyl 2-[4-[4-[2-methyl-4-(3-phenylpropylcarbamoyl)-2,3-dihydro-1,4-benzoxazin-7-yl]phenyl]cyclohexyl]acetate |
|---|---|
| PubChem CID | 58064463 |
| Molecular Formula | C34H40N2O4 |
| Molecular Weight | 540.70 g/mol |
| Exact Mass | 540.30 |
| IUPAC Name | methyl 2-[4-[4-[2-methyl-4-(3-phenylpropylcarbamoyl)-2,3-dihydro-1,4-benzoxazin-7-yl]phenyl]cyclohexyl]acetate |
| SMILES | COC(=O)CC1CCC(c2ccc(-c3ccc4c(c3)OC(C)CN4C(=O)NCCCc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C34H40N2O4/c1-24-23-36(34(38)35-20-6-9-25-7-4-3-5-8-25)31-19-18-30(22-32(31)40-24)29-16-14-28(15-17-29)27-12-10-26(11-13-27)21-33(37)39-2/h3-5,7-8,14-19,22,24,26-27H,6,9-13,20-21,23H2,1-2H3,(H,35,38) |
| InChIKey | FANCHBGPGIWMOT-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.70 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|