C24H32N4O3 — CID 70854018
triaminomethyl 2-[4-[4-(2-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-yl)phenyl]cyclohexyl]acetate (PubChem CID 70854018) has the molecular formula C24H32N4O3 and a molecular weight of 424.55 g/mol. Its IUPAC name is triaminomethyl 2-[4-[4-(2-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-yl)phenyl]cyclohexyl]acetate.
| Compound Name | triaminomethyl 2-[4-[4-(2-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-yl)phenyl]cyclohexyl]acetate |
|---|---|
| PubChem CID | 70854018 |
| Molecular Formula | C24H32N4O3 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | triaminomethyl 2-[4-[4-(2-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-yl)phenyl]cyclohexyl]acetate |
| SMILES | CC1CNc2ccc(-c3ccc(C4CCC(CC(=O)OC(N)(N)N)CC4)cc3)cc2O1 |
| InChI | InChI=1S/C24H32N4O3/c1-15-14-28-21-11-10-20(13-22(21)30-15)19-8-6-18(7-9-19)17-4-2-16(3-5-17)12-23(29)31-24(25,26)27/h6-11,13,15-17,28H,2-5,12,14,25-27H2,1H3 |
| InChIKey | PYQKPPBXPMGLRT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 125.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|