C31H42N2O4 — CID 91342393
3-[4-[4-[4-(hexylcarbamoyl)-2-methyl-2,3-dihydro-1,4-benzoxazin-7-yl]phenyl]cyclohexyl]propanoic acid (PubChem CID 91342393) has the molecular formula C31H42N2O4 and a molecular weight of 506.69 g/mol. Its IUPAC name is 3-[4-[4-[4-(hexylcarbamoyl)-2-methyl-2,3-dihydro-1,4-benzoxazin-7-yl]phenyl]cyclohexyl]propanoic acid.
| Compound Name | 3-[4-[4-[4-(hexylcarbamoyl)-2-methyl-2,3-dihydro-1,4-benzoxazin-7-yl]phenyl]cyclohexyl]propanoic acid |
|---|---|
| PubChem CID | 91342393 |
| Molecular Formula | C31H42N2O4 |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | 3-[4-[4-[4-(hexylcarbamoyl)-2-methyl-2,3-dihydro-1,4-benzoxazin-7-yl]phenyl]cyclohexyl]propanoic acid |
| SMILES | CCCCCCNC(=O)N1CC(C)Oc2cc(-c3ccc(C4CCC(CCC(=O)O)CC4)cc3)ccc21 |
| InChI | InChI=1S/C31H42N2O4/c1-3-4-5-6-19-32-31(36)33-21-22(2)37-29-20-27(16-17-28(29)33)26-14-12-25(13-15-26)24-10-7-23(8-11-24)9-18-30(34)35/h12-17,20,22-24H,3-11,18-19,21H2,1-2H3,(H,32,36)(H,34,35) |
| InChIKey | CZFPNRFLHOOKNH-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|