C31H40N2O4 — CID 91081221
2-[4-[4-[1-(heptan-2-ylcarbamoyl)-4-oxo-2,3-dihydroquinolin-6-yl]phenyl]cyclohexyl]acetic acid (PubChem CID 91081221) has the molecular formula C31H40N2O4 and a molecular weight of 504.67 g/mol. Its IUPAC name is 2-[4-[4-[1-(heptan-2-ylcarbamoyl)-4-oxo-2,3-dihydroquinolin-6-yl]phenyl]cyclohexyl]acetic acid.
| Compound Name | 2-[4-[4-[1-(heptan-2-ylcarbamoyl)-4-oxo-2,3-dihydroquinolin-6-yl]phenyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 91081221 |
| Molecular Formula | C31H40N2O4 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.30 |
| IUPAC Name | 2-[4-[4-[1-(heptan-2-ylcarbamoyl)-4-oxo-2,3-dihydroquinolin-6-yl]phenyl]cyclohexyl]acetic acid |
| SMILES | CCCCCC(C)NC(=O)N1CCC(=O)c2cc(-c3ccc(C4CCC(CC(=O)O)CC4)cc3)ccc21 |
| InChI | InChI=1S/C31H40N2O4/c1-3-4-5-6-21(2)32-31(37)33-18-17-29(34)27-20-26(15-16-28(27)33)25-13-11-24(12-14-25)23-9-7-22(8-10-23)19-30(35)36/h11-16,20-23H,3-10,17-19H2,1-2H3,(H,32,37)(H,35,36) |
| InChIKey | MQTBCOLQEHTFSD-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|