C30H33NO4 — CID 147221966
methyl 2-[4-[4-[4-(naphthalene-2-carbonylamino)butanoyl]phenyl]cyclohexyl]acetate (PubChem CID 147221966) has the molecular formula C30H33NO4 and a molecular weight of 471.60 g/mol. Its IUPAC name is methyl 2-[4-[4-[4-(naphthalene-2-carbonylamino)butanoyl]phenyl]cyclohexyl]acetate.
| Compound Name | methyl 2-[4-[4-[4-(naphthalene-2-carbonylamino)butanoyl]phenyl]cyclohexyl]acetate |
|---|---|
| PubChem CID | 147221966 |
| Molecular Formula | C30H33NO4 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | methyl 2-[4-[4-[4-(naphthalene-2-carbonylamino)butanoyl]phenyl]cyclohexyl]acetate |
| SMILES | COC(=O)CC1CCC(c2ccc(C(=O)CCCNC(=O)c3ccc4ccccc4c3)cc2)CC1 |
| InChI | InChI=1S/C30H33NO4/c1-35-29(33)19-21-8-10-23(11-9-21)24-12-15-25(16-13-24)28(32)7-4-18-31-30(34)27-17-14-22-5-2-3-6-26(22)20-27/h2-3,5-6,12-17,20-21,23H,4,7-11,18-19H2,1H3,(H,31,34) |
| InChIKey | CHGFIMSMSQQKDN-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|