C24H19Cl2FN6 — CID 58065265
6-(2-chloro-6-fluorophenyl)-4-N-(4-chlorophenyl)-2-N-[(E)-(4-ethylphenyl)methylideneamino]-1,3,5-triazine-2,4-diamine (PubChem CID 58065265) has the molecular formula C24H19Cl2FN6 and a molecular weight of 481.36 g/mol. Its IUPAC name is 6-(2-chloro-6-fluorophenyl)-4-N-(4-chlorophenyl)-2-N-[(E)-(4-ethylphenyl)methylideneamino]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(2-chloro-6-fluorophenyl)-4-N-(4-chlorophenyl)-2-N-[(E)-(4-ethylphenyl)methylideneamino]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 58065265 |
| Molecular Formula | C24H19Cl2FN6 |
| Molecular Weight | 481.36 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | 6-(2-chloro-6-fluorophenyl)-4-N-(4-chlorophenyl)-2-N-[(E)-(4-ethylphenyl)methylideneamino]-1,3,5-triazine-2,4-diamine |
| SMILES | CCc1ccc(/C=N/Nc2nc(Nc3ccc(Cl)cc3)nc(-c3c(F)cccc3Cl)n2)cc1 |
| InChI | InChI=1S/C24H19Cl2FN6/c1-2-15-6-8-16(9-7-15)14-28-33-24-31-22(21-19(26)4-3-5-20(21)27)30-23(32-24)29-18-12-10-17(25)11-13-18/h3-14H,2H2,1H3,(H2,29,30,31,32,33)/b28-14+ |
| InChIKey | YEZCOQJCRSFPNF-CCVNUDIWSA-N |
| XLogP | 6.74 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.36 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|