C20H20F3N3O4S — CID 58065368
N-(pyridin-3-ylmethyl)-2-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-ylidene]acetamide (PubChem CID 58065368) has the molecular formula C20H20F3N3O4S and a molecular weight of 455.46 g/mol. Its IUPAC name is N-(pyridin-3-ylmethyl)-2-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-ylidene]acetamide.
| Compound Name | N-(pyridin-3-ylmethyl)-2-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-ylidene]acetamide |
|---|---|
| PubChem CID | 58065368 |
| Molecular Formula | C20H20F3N3O4S |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | N-(pyridin-3-ylmethyl)-2-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-ylidene]acetamide |
| SMILES | O=C(C=C1CCN(S(=O)(=O)c2ccc(OC(F)(F)F)cc2)CC1)NCc1cccnc1 |
| InChI | InChI=1S/C20H20F3N3O4S/c21-20(22,23)30-17-3-5-18(6-4-17)31(28,29)26-10-7-15(8-11-26)12-19(27)25-14-16-2-1-9-24-13-16/h1-6,9,12-13H,7-8,10-11,14H2,(H,25,27) |
| InChIKey | OOMQKUHGQYWIJP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|