C19H12FN3O3 — CID 58067465
(4-fluorophenyl) 2-[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)-2-pyridinyl]acetate (PubChem CID 58067465) has the molecular formula C19H12FN3O3 and a molecular weight of 349.32 g/mol. Its IUPAC name is (4-fluorophenyl) 2-[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)-2-pyridinyl]acetate.
| Compound Name | (4-fluorophenyl) 2-[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 58067465 |
| Molecular Formula | C19H12FN3O3 |
| Molecular Weight | 349.32 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | (4-fluorophenyl) 2-[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)-2-pyridinyl]acetate |
| SMILES | O=C(Cc1cc(-c2nc3ncccc3o2)ccn1)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C19H12FN3O3/c20-13-3-5-15(6-4-13)25-17(24)11-14-10-12(7-9-21-14)19-23-18-16(26-19)2-1-8-22-18/h1-10H,11H2 |
| InChIKey | YGMMTLWDUALGNG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 78.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|