C21H14F3N3O2S — CID 58067469
1-[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)-2-pyridinyl]-3-[4-(trifluoromethoxy)phenyl]propane-2-thione (PubChem CID 58067469) has the molecular formula C21H14F3N3O2S and a molecular weight of 429.42 g/mol. Its IUPAC name is 1-[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)-2-pyridinyl]-3-[4-(trifluoromethoxy)phenyl]propane-2-thione.
| Compound Name | 1-[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)-2-pyridinyl]-3-[4-(trifluoromethoxy)phenyl]propane-2-thione |
|---|---|
| PubChem CID | 58067469 |
| Molecular Formula | C21H14F3N3O2S |
| Molecular Weight | 429.42 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | 1-[4-([1,3]oxazolo[4,5-b]pyridin-2-yl)-2-pyridinyl]-3-[4-(trifluoromethoxy)phenyl]propane-2-thione |
| SMILES | FC(F)(F)Oc1ccc(CC(=S)Cc2cc(-c3nc4ncccc4o3)ccn2)cc1 |
| InChI | InChI=1S/C21H14F3N3O2S/c22-21(23,24)29-16-5-3-13(4-6-16)10-17(30)12-15-11-14(7-9-25-15)20-27-19-18(28-20)2-1-8-26-19/h1-9,11H,10,12H2 |
| InChIKey | CKTQJIPLQYXGGO-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 61.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.42 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|