About (2S)-2-methylhex-5-ynal
(2S)-2-methylhex-5-ynal (PubChem CID 58067912) has the molecular formula C7H10O
and a molecular weight of 110.16 g/mol. Its IUPAC name is (2S)-2-methylhex-5-ynal.
Molecular Properties
| Compound Name | (2S)-2-methylhex-5-ynal |
| PubChem CID | 58067912 |
| Molecular Formula | C7H10O |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.07 |
| IUPAC Name | (2S)-2-methylhex-5-ynal |
| SMILES | C#CCCC(C)C=O |
| InChI | InChI=1S/C7H10O/c1-3-4-5-7(2)6-8/h1,6-7H,4-5H2,2H3 |
| InChIKey | SETBWOIZNYKNLH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-methylhex-5-ynal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-methylhex-5-ynal?
The IUPAC name of (2S)-2-methylhex-5-ynal (CID 58067912) is (2S)-2-methylhex-5-ynal.
What is the SMILES notation for (2S)-2-methylhex-5-ynal?
The canonical SMILES for (2S)-2-methylhex-5-ynal is C#CCCC(C)C=O.
What is the InChIKey of (2S)-2-methylhex-5-ynal?
The InChIKey is SETBWOIZNYKNLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O/c1-3-4-5-7(2)6-8/h1,6-7H,4-5H2,2H3.
What are the key properties of (2S)-2-methylhex-5-ynal?
(2S)-2-methylhex-5-ynal has a molecular weight of 110.16 g/mol, XLogP of 1.23, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-methylhex-5-ynal is sourced from PubChem (CID 58067912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).